* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INOSITOL 1,4-BISPHOSPHATE, D-[INOSITOL-2-3H(N)]- |
| English Synonyms: | INOSITOL 1,4-BISPHOSPHATE, D-[INOSITOL-2-3H(N)]- |
| MDL Number.: | MFCD00189817 |
| H bond acceptor: | 12 |
| H bond donor: | 8 |
| Smile: | [3H][C@@]1(O)[C@H](O)[C@@H](OP(O)(O)=O)[C@H](O)[C@@H](O)[C@@H]1OP(O)(O)=O |
| InChi: | InChI=1S/C6H14O12P2/c7-1-2(8)6(18-20(14,15)16)4(10)3(9)5(1)17-19(11,12)13/h1-10H,(H2,11,12,13)(H2,14,15,16)/t1-,2-,3+,4+,5+,6+/i1T/m0/s1 |
| InChiKey: | InChIKey=PELZSPZCXGTUMR-IFXCKTFNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.