* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INOSITOL-1-PHOSPHATE, D-[INOSITOL-14C(U)] |
| English Synonyms: | INOSITOL-1-PHOSPHATE, D-[INOSITOL-14C(U)] |
| MDL Number.: | MFCD00189824 |
| H bond acceptor: | 9 |
| H bond donor: | 7 |
| Smile: | [14C@@H]1([14C@@H]([14C@H]([14C@@H]([14C@@H]([14C@@H]1O)O)OP(=O)(O)O)O)O)O |
| InChi: | InChI=1S/C6H13O9P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-11H,(H2,12,13,14)/t1-,2-,3+,4-,5-,6-/m1/s1/i1+2,2+2,3+2,4+2,5+2,6+2 |
| InChiKey: | InChIKey=INAPMGSXUVUWAF-DAKALOQGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.