Molecular Structure:
CCD No.:CCD00089711
INOSITOL-3-PHOSPHATE, D-[INOSITOL-2-3H(N)]
Formula:C6 H12 O9 P T
MolWeight:262.142
![INOSITOL-3-PHOSPHATE, D-[INOSITOL-2-3H(N)] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | INOSITOL-3-PHOSPHATE, D-[INOSITOL-2-3H(N)] |
| English Synonyms： | INOSITOL-3-PHOSPHATE, D-[INOSITOL-2-3H(N)] |
| MDL Number.： | MFCD00189826 |
| H bond acceptor： | 9 |
| H bond donor： | 7 |
| Smile： | [3H][C@@]1([C@H]([C@@H]([C@H]([C@@H]([C@H]1OP(=O)(O)O)O)O)O)O)O |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
