* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IODOACETAMIDE [1-14 C] |
CAS: | 19333-30-3 |
English Synonyms: | IODOACETAMIDE [1-14 C] |
MDL Number.: | MFCD00189829 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C([14C](=O)N)I |
InChi: | InChI=1S/C2H4INO/c3-1-2(4)5/h1H2,(H2,4,5)/i2+2 |
InChiKey: | InChIKey=PGLTVOMIXTUURA-HQMMCQRPSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.