* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IODOACETAMIDE [1-14 C] |
| CAS: | 19333-30-3 |
| English Synonyms: | IODOACETAMIDE [1-14 C] |
| MDL Number.: | MFCD00189829 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C([14C](=O)N)I |
| InChi: | InChI=1S/C2H4INO/c3-1-2(4)5/h1H2,(H2,4,5)/i2+2 |
| InChiKey: | InChIKey=PGLTVOMIXTUURA-HQMMCQRPSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.