Molecular Structure:
CCD No.:CCD00089718
IODOANTIPYRINE, 4-[N-METHYL-3H]
Formula:C11 H8 I N2 O T3
MolWeight:320.145
![IODOANTIPYRINE, 4-[N-METHYL-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | IODOANTIPYRINE, 4-[N-METHYL-3H] |
| English Synonyms： | IODOANTIPYRINE, 4-[N-METHYL-3H] |
| MDL Number.： | MFCD00189834 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | [3H]C([3H])([3H])n1c(c(c(=O)n1c2ccccc2)I)C |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
