* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VALINE, L-[3,4-3H]- |
| English Synonyms: | VALINE, L-[3,4-3H]- |
| MDL Number.: | MFCD00190079 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [3H]C([3H])([3H])C([3H])([C@H](N)C(O)=O)C([3H])([3H])[3H] |
| InChi: | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1T3,2T3,3T |
| InChiKey: | InChIKey=KZSNJWFQEVHDMF-DNANVKQNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.