* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-ONAP(1) |
| English Synonyms: | Z-L-ALANINE 1-NAPHTHYL ESTER ; Z-ALA-ONAP(1) |
| MDL Number.: | MFCD00191047 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C[C@@H](C(=O)Oc1cccc2c1cccc2)NC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C21H19NO4/c1-15(22-21(24)25-14-16-8-3-2-4-9-16)20(23)26-19-13-7-11-17-10-5-6-12-18(17)19/h2-13,15H,14H2,1H3,(H,22,24)/t15-/m0/s1 |
| InChiKey: | InChIKey=YKQVLRZRCXFRGH-HNNXBMFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.