* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-SER(TBU)-ASN(TRT)-LEU-OME |
| English Synonyms: | Z-SER(TBU)-ASN(TRT)-LEU-OME |
| MDL Number.: | MFCD00191074 |
| H bond acceptor: | 12 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)OC)NC(=O)[C@H](CC(=O)NC(c1ccccc1)(c2ccccc2)c3ccccc3)NC(=O)[C@H](COC(C)(C)C)NC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C45H54N4O8/c1-31(2)27-37(42(53)55-6)47-40(51)36(46-41(52)38(30-57-44(3,4)5)48-43(54)56-29-32-19-11-7-12-20-32)28-39(50)49-45(33-21-13-8-14-22-33,34-23-15-9-16-24-34)35-25-17-10-18-26-35/h7-26,31,36-38H,27-30H2,1-6H3,(H,46,52)(H,47,51)(H,48,54)(H,49,50)/t36-,37-,38-/m0/s1 |
| InChiKey: | InChIKey=KNJMDTBKFPQZGB-QXUSSCGESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.