* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-THR(TBU)-OME |
| CAS: | 52785-41-8 |
| English Synonyms: | Z-THR(TBU)-OME |
| MDL Number.: | MFCD00191075 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | C[C@H]([C@@H](C(=O)OC)NC(=O)OCc1ccccc1)OC(C)(C)C |
| InChi: | InChI=1S/C17H25NO5/c1-12(23-17(2,3)4)14(15(19)21-5)18-16(20)22-11-13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3,(H,18,20)/t12-,14+/m1/s1 |
| InChiKey: | InChIKey=NKWFWFWEJCKORD-OCCSQVGLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.