* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLU-VAL-OH |
| English Synonyms: | Z-L-ALPHA-GLUTAMYL-L-VALINE ; Z-GLU-VAL-OH |
| MDL Number.: | MFCD00191095 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C18H24N2O7/c1-11(2)15(17(24)25)20-16(23)13(8-9-14(21)22)19-18(26)27-10-12-6-4-3-5-7-12/h3-7,11,13,15H,8-10H2,1-2H3,(H,19,26)(H,20,23)(H,21,22)(H,24,25)/t13-,15-/m0/s1 |
| InChiKey: | InChIKey=JAMNMAWEXOZINZ-ZFWWWQNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.