* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-GLU-OH |
| CAS: | 3916-39-0 |
| English Synonyms: | Z-GLY-GLU-OH ; Z-GLYCYL-L-GLUTAMIC ACID |
| MDL Number.: | MFCD00191097 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChi: | InChI=1S/C15H18N2O7/c18-12(17-11(14(21)22)6-7-13(19)20)8-16-15(23)24-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,16,23)(H,17,18)(H,19,20)(H,21,22)/t11-/m0/s1 |
| InChiKey: | InChIKey=JBGBOEMFZSZCMX-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.