* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS-ALA-OH |
| CAS: | 13056-38-7 |
| English Synonyms: | Z-HIS-ALA-OH ; Z-L-HISTIDYL-L-ALANINE |
| MDL Number.: | MFCD00191106 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | C[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C17H20N4O5/c1-11(16(23)24)20-15(22)14(7-13-8-18-10-19-13)21-17(25)26-9-12-5-3-2-4-6-12/h2-6,8,10-11,14H,7,9H2,1H3,(H,18,19)(H,20,22)(H,21,25)(H,23,24)/t11-,14-/m0/s1 |
| InChiKey: | InChIKey=UIHDXSNRWRHJRT-FZMZJTMJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.