* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS-VAL-OH |
| CAS: | 106172-66-1 |
| English Synonyms: | Z-L-HISTIDYL-L-VALINE ; Z-HIS-VAL-OH |
| MDL Number.: | MFCD00191109 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C19H24N4O5/c1-12(2)16(18(25)26)23-17(24)15(8-14-9-20-11-21-14)22-19(27)28-10-13-6-4-3-5-7-13/h3-7,9,11-12,15-16H,8,10H2,1-2H3,(H,20,21)(H,22,27)(H,23,24)(H,25,26)/t15-,16-/m0/s1 |
| InChiKey: | InChIKey=LYALYFZHXCPBAR-HOTGVXAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.