* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-D-LEU-D-ALA-OH |
| English Synonyms: | Z-L-LEUCYL-D-ALANINE ; Z-D-LEU-D-ALA-OH |
| MDL Number.: | MFCD00191115 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)C[C@H](C(=O)N[C@H](C)C(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C17H24N2O5/c1-11(2)9-14(15(20)18-12(3)16(21)22)19-17(23)24-10-13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3,(H,18,20)(H,19,23)(H,21,22)/t12-,14-/m1/s1 |
| InChiKey: | InChIKey=CWMXJBNCYBDNTJ-TZMCWYRMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.