* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-L-LEUCYL-GLYCINE AMIDE |
| English Synonyms: | Z-L-LEUCYL-GLYCINE AMIDE ; Z-LEU-GLY-NH2 |
| MDL Number.: | MFCD00191121 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)C[C@@H](C(=O)NCC(=O)N)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C16H23N3O4/c1-11(2)8-13(15(21)18-9-14(17)20)19-16(22)23-10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H2,17,20)(H,18,21)(H,19,22)/t13-/m0/s1 |
| InChiKey: | InChIKey=CXGBLURSBILIIW-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.