* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LEU-SER-OH |
| English Synonyms: | Z-L-LEUCYL-L-SERINE ; Z-LEU-SER-OH |
| MDL Number.: | MFCD00191125 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C17H24N2O6/c1-11(2)8-13(15(21)18-14(9-20)16(22)23)19-17(24)25-10-12-6-4-3-5-7-12/h3-7,11,13-14,20H,8-10H2,1-2H3,(H,18,21)(H,19,24)(H,22,23)/t13-,14-/m0/s1 |
| InChiKey: | InChIKey=GWPUZERGHCXEDZ-KBPBESRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.