* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LYS-PNA |
| CAS: | 70144-71-7 |
| English Synonyms: | Z-LYS-PNA |
| MDL Number.: | MFCD00191129 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](CCCCN)C(=O)Nc2ccc(cc2)[N+](=O)[O-] |
| InChi: | InChI=1S/C20H24N4O5/c21-13-5-4-8-18(23-20(26)29-14-15-6-2-1-3-7-15)19(25)22-16-9-11-17(12-10-16)24(27)28/h1-3,6-7,9-12,18H,4-5,8,13-14,21H2,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChiKey: | InChIKey=FKFJWYPXPIUVGU-SFHVURJKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.