* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-THR(TBU)-PRO-NH2 |
| English Synonyms: | Z-THR(TBU)-PRO-NH2 |
| MDL Number.: | MFCD00191159 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)N)NC(=O)OCc2ccccc2)OC(C)(C)C |
| InChi: | InChI=1S/C21H31N3O5/c1-14(29-21(2,3)4)17(19(26)24-12-8-11-16(24)18(22)25)23-20(27)28-13-15-9-6-5-7-10-15/h5-7,9-10,14,16-17H,8,11-13H2,1-4H3,(H2,22,25)(H,23,27)/t14-,16+,17+/m1/s1 |
| InChiKey: | InChIKey=LIDCOTHVUCQELB-PVAVHDDUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.