* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-L-THREONYL-L-PROLINE |
| English Synonyms: | Z-L-THREONYL-L-PROLINE ; Z-THR-PRO-OH |
| MDL Number.: | MFCD00191277 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCc2ccccc2)O |
| InChi: | InChI=1S/C17H22N2O6/c1-11(20)14(15(21)19-9-5-8-13(19)16(22)23)18-17(24)25-10-12-6-3-2-4-7-12/h2-4,6-7,11,13-14,20H,5,8-10H2,1H3,(H,18,24)(H,22,23)/t11-,13+,14+/m1/s1 |
| InChiKey: | InChIKey=SNLXPAJERLFVRH-XBFCOCLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.