* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-(1-PROPENYLOXYMETHYL)-1,3-DIOXOLAN-2-ONE |
CAS: | 130221-78-2 |
English Synonyms: | 4-(1-PROPENYLOXYMETHYL)-1,3-DIOXOLAN-2-ONE ; 4-([(1E)-PROP-1-EN-1-YLOXY]METHYL)-1,3-DIOXOLAN-2-ONE |
MDL Number.: | MFCD00192418 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C/C=C/OCC1COC(=O)O1 |
InChi: | InChI=1S/C7H10O4/c1-2-3-9-4-6-5-10-7(8)11-6/h2-3,6H,4-5H2,1H3/b3-2+ |
InChiKey: | InChIKey=YFXXJQJIGQHZSG-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.