Molecular Structure:
CCD No.:CCD00092303
ZERENEX E/4045244
Formula:C10 H13 N3 O2 S2
MolWeight:271.364
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/4045244 |
| English Synonyms： | ZERENEX E/4045244 |
| MDL Number.： | MFCD00194271 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | C=CCNC(=S)Nc1ccc(cc1)S(=O)(=O)N |
| InChi： | InChI=1S/C10H13N3O2S2/c1-2-7-12-10(16)13-8-3-5-9(6-4-8)17(11,14)15/h2-6H,1,7H2,(H2,11,14,15)(H2,12,13,16) |
| InChiKey： | InChIKey=RUUMGAGVWQPAAS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
