* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLT-ALA-ALA-PHE-MCA |
English Synonyms: | GLT-ALA-ALA-PHE-MCA |
MDL Number.: | MFCD00198199 |
H bond acceptor: | 11 |
H bond donor: | 3 |
Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H](C)NC(=O)[C@H](C)N4C(=O)CCCC4=O |
InChi: | InChI=1S/C30H32N4O7/c1-17-14-27(37)41-24-16-21(12-13-22(17)24)32-30(40)23(15-20-8-5-4-6-9-20)33-28(38)18(2)31-29(39)19(3)34-25(35)10-7-11-26(34)36/h4-6,8-9,12-14,16,18-19,23H,7,10-11,15H2,1-3H3,(H,31,39)(H,32,40)(H,33,38)/t18-,19-,23-/m0/s1 |
InChiKey: | InChIKey=WFXLUISASRFHIM-YDHSSHFGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.