* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROCINONIDE |
| CAS: | 58497-00-0 |
| English Synonyms: | PROCINONIDE |
| MDL Number.: | MFCD00200408 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCC(=O)OCC(=O)[C@@]12[C@@H](C[C@@H]3[C@@]1(C[C@@H]([C@]4([C@H]3C[C@@H](C5=CC(=O)C=C[C@@]54C)F)F)O)C)OC(O2)(C)C |
| InChi: | InChI=1S/C27H34F2O7/c1-6-22(33)34-13-20(32)27-21(35-23(2,3)36-27)11-15-16-10-18(28)17-9-14(30)7-8-24(17,4)26(16,29)19(31)12-25(15,27)5/h7-9,15-16,18-19,21,31H,6,10-13H2,1-5H3/t15-,16-,18-,19-,21+,24-,25-,26-,27+/m0/s1 |
| InChiKey: | InChIKey=UBOIMZIXNXGQOH-RTWVSBIPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.