* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL FB 0009 |
| English Synonyms: | RARECHEM AL FB 0009 |
| MDL Number.: | MFCD00204632 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C[N+](=C/C=C(/c1ccc(cc1)F)\Cl)C.[O-]Cl(=O)(=O)=O |
| InChi: | InChI=1S/C11H12ClFN.ClHO4/c1-14(2)8-7-11(12)9-3-5-10(13)6-4-9;2-1(3,4)5/h3-8H,1-2H3;(H,2,3,4,5)/q+1;/p-1/b11-7-; |
| InChiKey: | InChIKey=YKRPMTJJNTVFJZ-AJULUCINSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.