* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FC 0046 |
English Synonyms: | RARECHEM AL FC 0046 |
MDL Number.: | MFCD00204663 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)Cc2ccc[n+](c2)/C=C/C(=O)c3ccccc3.[Cl-] |
InChi: | InChI=1S/C21H18NO.ClH/c23-21(20-11-5-2-6-12-20)13-15-22-14-7-10-19(17-22)16-18-8-3-1-4-9-18;/h1-15,17H,16H2;1H/q+1;/p-1/b15-13+; |
InChiKey: | InChIKey=KZUIYDNKPKQZII-GVYCEHEKSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.