* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FG 0083 |
English Synonyms: | RARECHEM AL FG 0083 |
MDL Number.: | MFCD00204712 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2ncc(c(n2)c3cccc(c3)Cl)c4nnnn4c5ccccc5 |
InChi: | InChI=1S/C23H15ClN6/c24-18-11-7-10-17(14-18)21-20(15-25-22(26-21)16-8-3-1-4-9-16)23-27-28-29-30(23)19-12-5-2-6-13-19/h1-15H |
InChiKey: | InChIKey=UNMOEOQTWMTQJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.