Molecular Structure:
CCD No.:CCD00096386
ISOPHTHALIC-2,4,5,6-D4 ACID
CAS No.:
148472-48-4
Formula:C8 H2 D4 O4
MolWeight:170.156
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ISOPHTHALIC-2,4,5,6-D4 ACID |
| CAS： | 148472-48-4 |
| English Synonyms： | ISOPHTHALIC-2,4,5,6-D4 ACID ; 1,3-BENZENEDICARBOXYLIC ACID-2,4,5,6-D4 |
| MDL Number.： | MFCD00209746 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | [2H]c1c(c(c(c(c1[2H])C(=O)O)[2H])C(=O)O)[2H] |
| InChiKey： | InChIKey=null |
|
|
| Information： | 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
