* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-THREONINE-15N |
English Synonyms: | L-THREONINE-15N |
MDL Number.: | MFCD00209793 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C[C@H]([C@@H](C(=O)O)[15NH2])O |
InChi: | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i5+1 |
InChiKey: | InChIKey=AYFVYJQAPQTCCC-SZEKAKMSSA-N |
Property |
|
Melting Point: | 256 DEG C (DEC)(LIT) |
Comments: | ASSAY METHOD: CP MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]20/D -27.4 DEG, C = 1 IN H2O UNSPSC: 12142200 WGK: 3 |
Information: | ISOTOPIC PURITY: 98 ATOM % 15N MW: 120.11 BY ATOM % CALCULATION |
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.