* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-2H-PYRIDO[2,3-B]-1,4-OXAZIN-3(4H)-ONE |
CAS: | 105544-39-6 |
English Synonyms: | 6-CHLORO-1H,2H,3H-PYRIDO[2,3-B][1,4]OXAZIN-2-ONE ; 7-CHLORO-2H-PYRIDO[2,3-B]-1,4-OXAZIN-3(4H)-ONE |
MDL Number.: | MFCD00209963 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(nc2c1NC(=O)CO2)Cl |
InChi: | InChI=1S/C7H5ClN2O2/c8-5-2-1-4-7(10-5)12-3-6(11)9-4/h1-2H,3H2,(H,9,11) |
InChiKey: | InChIKey=QZCXKQHUJLFAAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.