* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-AMINO-4-(2,5,8-TRIOXANONYL)COUMARIN |
| CAS: | 146773-33-3 |
| English Synonyms: | 7-AMINO-4-(2,5,8-TRIOXANONYL)COUMARIN |
| MDL Number.: | MFCD00210010 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COCCOCCOCc1cc(=O)oc2c1ccc(c2)N |
| InChi: | InChI=1S/C15H19NO5/c1-18-4-5-19-6-7-20-10-11-8-15(17)21-14-9-12(16)2-3-13(11)14/h2-3,8-9H,4-7,10,16H2,1H3 |
| InChiKey: | InChIKey=WDUHFRHYZNNRGQ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.