* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOCEMBROL |
| CAS: | 20489-82-1 |
| English Synonyms: | ISOCEMBROL ; THUNBERGOL |
| MDL Number.: | MFCD00210517 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C/C/1=C/CC[C@@](/C=C/[C@@H](CC/C(=C/CC1)/C)C(C)C)(C)O |
| InChi: | InChI=1S/C20H34O/c1-16(2)19-12-11-18(4)9-6-8-17(3)10-7-14-20(5,21)15-13-19/h9-10,13,15-16,19,21H,6-8,11-12,14H2,1-5H3/b15-13+,17-10-,18-9+/t19-,20-/m1/s1 |
| InChiKey: | InChIKey=YAPXSYXFLHDPCK-RJTGTAKJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.