Molecular Structure:
CCD No.:CCD00097130
GAMMA-AMINO-N-BUTYRIC ACID [2,3,4-3H]
Formula:C4 H6 N O2 T3
MolWeight:109.144
![GAMMA-AMINO-N-BUTYRIC ACID [2,3,4-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | GAMMA-AMINO-N-BUTYRIC ACID [2,3,4-3H] |
| English Synonyms： | GAMMA-AMINO-N-BUTYRIC ACID [2,3,4-3H] |
| MDL Number.： | MFCD00210740 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | [3H]C(C([3H])C(=O)O)C([3H])N |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
