Molecular Structure:
CCD No.:CCD00097233
GUANOSINE, [8-3H]
Formula:C10 H12 N5 O5 T
MolWeight:285.251
![GUANOSINE, [8-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | GUANOSINE, [8-3H] |
| English Synonyms： | GUANOSINE, [8-3H] |
| MDL Number.： | MFCD00210981 |
| H bond acceptor： | 10 |
| H bond donor： | 5 |
| Smile： | [3H]c1nc2c(=O)[nH]c(nc2n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
