* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUAZINONE |
| CAS: | 70018-51-8 ;105622-85-3 |
| English Synonyms: | R 13-6438 ; QUAZINONE ; RO 13-6438 |
| MDL Number.: | MFCD00211176 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C[C@@H]1C(=O)NC2=Nc3cccc(c3CN12)Cl |
| InChi: | InChI=1S/C11H10ClN3O/c1-6-10(16)14-11-13-9-4-2-3-8(12)7(9)5-15(6)11/h2-4,6H,5H2,1H3,(H,13,14,16)/t6-/m1/s1 |
| InChiKey: | InChIKey=BHZFZYLBVSWUMT-ZCFIWIBFSA-N |
|
|
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.