Molecular Structure:
CCD No.:CCD00098366
ADENINE-1,3-15N2
CAS No.:
97908-71-9
Formula:C5 H5 N5
MolWeight:137.115
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | ADENINE-1,3-15N2 |
| CAS： | 97908-71-9 |
| English Synonyms： | 6-AMINOPURINE-15N2 ; ADENINE-1,3-15N2 ; VITAMIN B4-15N2 |
| MDL Number.： | MFCD00213651 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1[nH]c2c(n1)c([15n]c[15n]2)N |
| InChi： | InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)/i8+1,10+1 |
| InChiKey： | InChIKey=GFFGJBXGBJISGV-GAWGKFCISA-N |
|
|
| Melting Point： | 360-365 DEG C (SUBL)(LIT) |
| Comments： | ASSAY METHOD: CP MASS SHIFT: M+2 WGK: 3 |
| Information： | ISOTOPIC PURITY: 98 ATOM % 15N MW: 137.08 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
