* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GONYAUTOXIN II |
| CAS: | 60508-89-6 |
| English Synonyms: | GONYAUTOXIN II |
| MDL Number.: | MFCD00213821 |
| H bond acceptor: | 15 |
| H bond donor: | 7 |
| Smile: | C1[C@H](C([C@@]23N1C(=N[C@H]([C@@H]2N=C(N3)N)COC(=O)N)N)(O)O)OS(=O)(=O)O |
| InChi: | InChI=1S/C10H17N7O8S/c11-6-15-5-3(2-24-8(13)18)14-7(12)17-1-4(25-26(21,22)23)10(19,20)9(5,17)16-6/h3-5,19-20H,1-2H2,(H2,12,14)(H2,13,18)(H3,11,15,16)(H,21,22,23)/t3-,4+,5-,9-/m0/s1 |
| InChiKey: | InChIKey=ARSXTTJGWGCRRR-XXKOCQOQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.