* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3-/3,4-DIMETHYLPHENANTHRENE |
CAS: | 66291-31-4 ;3674-65-5 |
English Synonyms: | 2,3-/3,4-DIMETHYLPHENANTHRENE ; 2,3-/3,4-DMP |
MDL Number.: | MFCD00216230 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cc1ccc2ccc3ccccc3c2c1C.Cc1cc2ccc3ccccc3c2cc1C |
InChi: | InChI=1S/2C16H14/c1-11-9-14-8-7-13-5-3-4-6-15(13)16(14)10-12(11)2;1-11-7-8-14-10-9-13-5-3-4-6-15(13)16(14)12(11)2/h2*3-10H,1-2H3 |
InChiKey: | InChIKey=RNWATGNQAHUPHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.