* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCEROL, [2-14C] TRINITRATE |
English Synonyms: | GLYCEROL, [2-14C] TRINITRATE |
MDL Number.: | MFCD00216389 |
H bond acceptor: | 12 |
H bond donor: | 0 |
Smile: | C([14CH](CO[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-] |
InChi: | InChI=1S/C3H5N3O9/c7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3H,1-2H2/i3+2 |
InChiKey: | InChIKey=SNIOPGDIGTZGOP-YZRHJBSPSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.