* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GOLD ACETATE |
| English Synonyms: | GOLD ACETATE |
| MDL Number.: | MFCD00216545 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(=O)O[Au] |
| InChi: | InChI=1S/C2H4O2.Au/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChiKey: | InChIKey=JBQSGEYZFOJMED-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.