Molecular Structure:
CCD No.:CCD00101624
ZERENEX E/5111209
Formula:C12 H11 N3 O5
MolWeight:277.235
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/5111209 |
| English Synonyms： | ZERENEX E/5111209 |
| MDL Number.： | MFCD00218197 |
| H bond acceptor： | 8 |
| H bond donor： | 1 |
| Smile： | c1cc(cc(c1)[N+](=O)[O-])c2nc(on2)CCCC(=O)O |
| InChi： | InChI=1S/C12H11N3O5/c16-11(17)6-2-5-10-13-12(14-20-10)8-3-1-4-9(7-8)15(18)19/h1,3-4,7H,2,5-6H2,(H,16,17) |
| InChiKey： | InChIKey=LQQYZJRCWBRIMW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
