* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FL 0074 |
English Synonyms: | RARECHEM AL FL 0074 |
MDL Number.: | MFCD00219431 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CN(C)/C=C(/c1nnnn1c2ccccc2)\C(=O)c3cc(cc(c3)F)F |
InChi: | InChI=1S/C18H15F2N5O/c1-24(2)11-16(17(26)12-8-13(19)10-14(20)9-12)18-21-22-23-25(18)15-6-4-3-5-7-15/h3-11H,1-2H3/b16-11+ |
InChiKey: | InChIKey=LNOHNCQMXRHSDF-LFIBNONCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.