* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FH 0089 |
English Synonyms: | RARECHEM AL FH 0089 |
MDL Number.: | MFCD00219432 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1ccccc1c2c(cnc(n2)N)c3nnnn3c4ccc(cc4)Cl |
InChi: | InChI=1S/C18H14ClN7/c1-11-4-2-3-5-14(11)16-15(10-21-18(20)22-16)17-23-24-25-26(17)13-8-6-12(19)7-9-13/h2-10H,1H3,(H2,20,21,22) |
InChiKey: | InChIKey=ZPJXQWYMAUZMQE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.