* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2,4,4,6,6-HEXAMETHYLHEPTANE |
CAS: | 34701-49-0 |
English Synonyms: | 2,2,4,4,6,6-HEXAMETHYLHEPTANE |
MDL Number.: | MFCD00220575 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)(C)CC(C)(C)CC(C)(C)C |
InChi: | InChI=1S/C13H28/c1-11(2,3)9-13(7,8)10-12(4,5)6/h9-10H2,1-8H3 |
InChiKey: | InChIKey=LIMYLTFOQJHNJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.