Molecular Structure:
CCD No.:CCD00103085
ZERENEX E/6022314
Formula:C11 H11 N5 O3
MolWeight:261.24
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6022314 |
| English Synonyms： | ZERENEX E/6022314 |
| MDL Number.： | MFCD00224035 |
| H bond acceptor： | 8 |
| H bond donor： | 2 |
| Smile： | c1ccc(cc1)CC(=O)O/N=C(/c2c(non2)N)\N |
| InChi： | InChI=1S/C11H11N5O3/c12-10(9-11(13)16-19-14-9)15-18-8(17)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,12,15)(H2,13,16) |
| InChiKey： | InChIKey=CMXLPMSJPZTVOO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
