* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ NN 0037 |
English Synonyms: | RARECHEM AQ NN 0037 |
MDL Number.: | MFCD00225142 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)CN2CCN(C2c3ccc(cc3)[N+](=O)[O-])Cc4ccccc4 |
InChi: | InChI=1S/C23H23N3O2/c27-26(28)22-13-11-21(12-14-22)23-24(17-19-7-3-1-4-8-19)15-16-25(23)18-20-9-5-2-6-10-20/h1-14,23H,15-18H2 |
InChiKey: | InChIKey=HGQZVRWIMOXMIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.