* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9(10H)-ANTHRACENONE, 10-DIAZO- |
CAS: | 1705-82-4 |
English Synonyms: | 10-DIAZO-9(10H)-ANTHRACENONE ; 9(10H)-ANTHRACENONE, 10-DIAZO- ; 10-DIAZO-10H-ANTHRACEN-9-ONE |
MDL Number.: | MFCD00226701 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)C(=[N+]=[N-])c3ccccc3C2=O |
InChi: | InChI=1S/C14H8N2O/c15-16-13-9-5-1-3-7-11(9)14(17)12-8-4-2-6-10(12)13/h1-8H |
InChiKey: | InChIKey=ZAMUDYFFFFHBNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.