* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-NITRO-(1,2,4)TRIAZOLO(1,5-A)PYRIMIDIN-2-YLAMINE |
| CAS: | 80773-01-9 |
| English Synonyms: | 6-NITRO-(1,2,4)TRIAZOLO(1,5-A)PYRIMIDIN-2-YLAMINE ; 6-NITRO-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
| MDL Number.: | MFCD00227183 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | c1c(cn2c(n1)nc(n2)N)[N+](=O)[O-] |
| InChi: | InChI=1S/C5H4N6O2/c6-4-8-5-7-1-3(11(12)13)2-10(5)9-4/h1-2H,(H2,6,9) |
| InChiKey: | InChIKey=OEPACHSODSKQIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.