* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BD AN03 |
| English Synonyms: | RARECHEM AQ BD AN03 |
| MDL Number.: | MFCD00229433 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | COc1c2ccccc2cc3c1cccc3 |
| InChi: | InChI=1S/C15H12O/c1-16-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-10H,1H3 |
| InChiKey: | InChIKey=DVRKZTKTNYRYLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.