* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURO[3,4-F]-1,3-BENZODIOXOL-5(7H)-ONE |
| CAS: | 4792-36-3 |
| English Synonyms: | FURO[3,4-F]-1,3-BENZODIOXOL-5(7H)-ONE |
| MDL Number.: | MFCD00230425 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1c2c(cc3c1OCO3)C(=O)OC2 |
| InChi: | InChI=1S/C9H6O4/c10-9-6-2-8-7(12-4-13-8)1-5(6)3-11-9/h1-2H,3-4H2 |
| InChiKey: | InChIKey=QIYDTIMMZOUCGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.