* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-(4-CHLOROSTYRYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
English Synonyms: | 7-(4-CHLOROSTYRYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
MDL Number.: | MFCD00232458 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1/C=C\c2ccnc3n2nc(n3)N)Cl |
InChi: | InChI=1S/C13H10ClN5/c14-10-4-1-9(2-5-10)3-6-11-7-8-16-13-17-12(15)18-19(11)13/h1-8H,(H2,15,18)/b6-3- |
InChiKey: | InChIKey=QWAYUNOMFDDJDC-UTCJRWHESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.